C15H16ClNO3S — CID 7510019
N-[(2-chlorophenyl)methyl]-4-methoxy-N-methylbenzenesulfonamide (PubChem CID 7510019) has the molecular formula C15H16ClNO3S and a molecular weight of 325.82 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-4-methoxy-N-methylbenzenesulfonamide.
| Compound Name | N-[(2-chlorophenyl)methyl]-4-methoxy-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 7510019 |
| Molecular Formula | C15H16ClNO3S |
| Molecular Weight | 325.82 g/mol |
| Exact Mass | 325.05 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-4-methoxy-N-methylbenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)N(C)Cc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C15H16ClNO3S/c1-17(11-12-5-3-4-6-15(12)16)21(18,19)14-9-7-13(20-2)8-10-14/h3-10H,11H2,1-2H3 |
| InChIKey | YQCVTPPLIJYQKX-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.82 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |