C15H12ClF4NO3S — CID 18191880
N-[(2-chlorophenyl)methyl]-2,3,5,6-tetrafluoro-4-methoxy-N-methylbenzenesulfonamide (PubChem CID 18191880) has the molecular formula C15H12ClF4NO3S and a molecular weight of 397.78 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-2,3,5,6-tetrafluoro-4-methoxy-N-methylbenzenesulfonamide.
| Compound Name | N-[(2-chlorophenyl)methyl]-2,3,5,6-tetrafluoro-4-methoxy-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 18191880 |
| Molecular Formula | C15H12ClF4NO3S |
| Molecular Weight | 397.78 g/mol |
| Exact Mass | 397.02 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-2,3,5,6-tetrafluoro-4-methoxy-N-methylbenzenesulfonamide |
| SMILES | COc1c(F)c(F)c(S(=O)(=O)N(C)Cc2ccccc2Cl)c(F)c1F |
| InChI | InChI=1S/C15H12ClF4NO3S/c1-21(7-8-5-3-4-6-9(8)16)25(22,23)15-12(19)10(17)14(24-2)11(18)13(15)20/h3-6H,7H2,1-2H3 |
| InChIKey | ITTNUOMVGJGRCE-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.78 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|