C12H15N5O3S — CID 64517256
2-methyl-5-[methyl(1H-1,2,4-triazol-5-ylmethyl)sulfamoyl]benzamide (PubChem CID 64517256) has the molecular formula C12H15N5O3S and a molecular weight of 309.35 g/mol. Its IUPAC name is 2-methyl-5-[methyl(1H-1,2,4-triazol-5-ylmethyl)sulfamoyl]benzamide.
| Compound Name | 2-methyl-5-[methyl(1H-1,2,4-triazol-5-ylmethyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 64517256 |
| Molecular Formula | C12H15N5O3S |
| Molecular Weight | 309.35 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | 2-methyl-5-[methyl(1H-1,2,4-triazol-5-ylmethyl)sulfamoyl]benzamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C)Cc2ncn[nH]2)cc1C(N)=O |
| InChI | InChI=1S/C12H15N5O3S/c1-8-3-4-9(5-10(8)12(13)18)21(19,20)17(2)6-11-14-7-15-16-11/h3-5,7H,6H2,1-2H3,(H2,13,18)(H,14,15,16) |
| InChIKey | MPGINALDAQOLNT-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 122.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.35 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |