C21H26ClNOS — CID 4830873
N-[(4-chlorophenyl)methyl]-2-cyclopentyl-N-(1-thiophen-2-ylpropan-2-yl)acetamide (PubChem CID 4830873) has the molecular formula C21H26ClNOS and a molecular weight of 375.97 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-2-cyclopentyl-N-(1-thiophen-2-ylpropan-2-yl)acetamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-2-cyclopentyl-N-(1-thiophen-2-ylpropan-2-yl)acetamide |
|---|---|
| PubChem CID | 4830873 |
| Molecular Formula | C21H26ClNOS |
| Molecular Weight | 375.97 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-2-cyclopentyl-N-(1-thiophen-2-ylpropan-2-yl)acetamide |
| SMILES | CC(Cc1cccs1)N(Cc1ccc(Cl)cc1)C(=O)CC1CCCC1 |
| InChI | InChI=1S/C21H26ClNOS/c1-16(13-20-7-4-12-25-20)23(15-18-8-10-19(22)11-9-18)21(24)14-17-5-2-3-6-17/h4,7-12,16-17H,2-3,5-6,13-15H2,1H3 |
| InChIKey | YGQCTEUYOBXHFM-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.97 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |