C21H20Cl2N2O2S — CID 16626042
5,6-dichloro-N-[(4-methoxyphenyl)methyl]-N-(1-thiophen-2-ylpropan-2-yl)pyridine-3-carboxamide (PubChem CID 16626042) has the molecular formula C21H20Cl2N2O2S and a molecular weight of 435.38 g/mol. Its IUPAC name is 5,6-dichloro-N-[(4-methoxyphenyl)methyl]-N-(1-thiophen-2-ylpropan-2-yl)pyridine-3-carboxamide.
| Compound Name | 5,6-dichloro-N-[(4-methoxyphenyl)methyl]-N-(1-thiophen-2-ylpropan-2-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 16626042 |
| Molecular Formula | C21H20Cl2N2O2S |
| Molecular Weight | 435.38 g/mol |
| Exact Mass | 434.06 |
| IUPAC Name | 5,6-dichloro-N-[(4-methoxyphenyl)methyl]-N-(1-thiophen-2-ylpropan-2-yl)pyridine-3-carboxamide |
| SMILES | COc1ccc(CN(C(=O)c2cnc(Cl)c(Cl)c2)C(C)Cc2cccs2)cc1 |
| InChI | InChI=1S/C21H20Cl2N2O2S/c1-14(10-18-4-3-9-28-18)25(13-15-5-7-17(27-2)8-6-15)21(26)16-11-19(22)20(23)24-12-16/h3-9,11-12,14H,10,13H2,1-2H3 |
| InChIKey | OOLZWRFYUAOMCO-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.38 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|