C20H16Cl3NO2S — CID 162666509
N-[(4-methoxyphenyl)methyl]-2-thiophen-2-yl-N-(2,4,5-trichlorophenyl)acetamide (PubChem CID 162666509) has the molecular formula C20H16Cl3NO2S and a molecular weight of 440.78 g/mol. Its IUPAC name is N-[(4-methoxyphenyl)methyl]-2-thiophen-2-yl-N-(2,4,5-trichlorophenyl)acetamide.
| Compound Name | N-[(4-methoxyphenyl)methyl]-2-thiophen-2-yl-N-(2,4,5-trichlorophenyl)acetamide |
|---|---|
| PubChem CID | 162666509 |
| Molecular Formula | C20H16Cl3NO2S |
| Molecular Weight | 440.78 g/mol |
| Exact Mass | 439.00 |
| IUPAC Name | N-[(4-methoxyphenyl)methyl]-2-thiophen-2-yl-N-(2,4,5-trichlorophenyl)acetamide |
| SMILES | COc1ccc(CN(C(=O)Cc2cccs2)c2cc(Cl)c(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C20H16Cl3NO2S/c1-26-14-6-4-13(5-7-14)12-24(20(25)9-15-3-2-8-27-15)19-11-17(22)16(21)10-18(19)23/h2-8,10-11H,9,12H2,1H3 |
| InChIKey | GNIKPAAIDXEZJW-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.78 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|