C20H17NO4S — CID 1034525
2-[(4-methoxyphenyl)methyl-(thiophene-2-carbonyl)amino]benzoic acid (PubChem CID 1034525) has the molecular formula C20H17NO4S and a molecular weight of 367.43 g/mol. Its IUPAC name is 2-[(4-methoxyphenyl)methyl-(thiophene-2-carbonyl)amino]benzoic acid.
| Compound Name | 2-[(4-methoxyphenyl)methyl-(thiophene-2-carbonyl)amino]benzoic acid |
|---|---|
| PubChem CID | 1034525 |
| Molecular Formula | C20H17NO4S |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | 2-[(4-methoxyphenyl)methyl-(thiophene-2-carbonyl)amino]benzoic acid |
| SMILES | COc1ccc(CN(C(=O)c2cccs2)c2ccccc2C(=O)O)cc1 |
| InChI | InChI=1S/C20H17NO4S/c1-25-15-10-8-14(9-11-15)13-21(19(22)18-7-4-12-26-18)17-6-3-2-5-16(17)20(23)24/h2-12H,13H2,1H3,(H,23,24) |
| InChIKey | VGEZSEDLOCUZNZ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |