C24H22N2O5 — CID 6899248
2-[[2-[(E)-benzylideneamino]oxyacetyl]-[(4-methoxyphenyl)methyl]amino]benzoic acid (PubChem CID 6899248) has the molecular formula C24H22N2O5 and a molecular weight of 418.45 g/mol. Its IUPAC name is 2-[[2-[(E)-benzylideneamino]oxyacetyl]-[(4-methoxyphenyl)methyl]amino]benzoic acid.
| Compound Name | 2-[[2-[(E)-benzylideneamino]oxyacetyl]-[(4-methoxyphenyl)methyl]amino]benzoic acid |
|---|---|
| PubChem CID | 6899248 |
| Molecular Formula | C24H22N2O5 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | 2-[[2-[(E)-benzylideneamino]oxyacetyl]-[(4-methoxyphenyl)methyl]amino]benzoic acid |
| SMILES | COc1ccc(CN(C(=O)CO/N=C/c2ccccc2)c2ccccc2C(=O)O)cc1 |
| InChI | InChI=1S/C24H22N2O5/c1-30-20-13-11-19(12-14-20)16-26(22-10-6-5-9-21(22)24(28)29)23(27)17-31-25-15-18-7-3-2-4-8-18/h2-15H,16-17H2,1H3,(H,28,29)/b25-15+ |
| InChIKey | SUNXEBKXEOTJQU-MFKUBSTISA-N |
| XLogP | 3.98 |
| TPSA | 88.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|