C28H26N2O3S — CID 1450044
(2S)-N-[(4-methoxyphenyl)methyl]-2-phenyl-2-(N-(2-thiophen-2-ylacetyl)anilino)acetamide (PubChem CID 1450044) has the molecular formula C28H26N2O3S and a molecular weight of 470.59 g/mol. Its IUPAC name is (2S)-N-[(4-methoxyphenyl)methyl]-2-phenyl-2-(N-(2-thiophen-2-ylacetyl)anilino)acetamide.
| Compound Name | (2S)-N-[(4-methoxyphenyl)methyl]-2-phenyl-2-(N-(2-thiophen-2-ylacetyl)anilino)acetamide |
|---|---|
| PubChem CID | 1450044 |
| Molecular Formula | C28H26N2O3S |
| Molecular Weight | 470.59 g/mol |
| Exact Mass | 470.17 |
| IUPAC Name | (2S)-N-[(4-methoxyphenyl)methyl]-2-phenyl-2-(N-(2-thiophen-2-ylacetyl)anilino)acetamide |
| SMILES | COc1ccc(CNC(=O)[C@H](c2ccccc2)N(C(=O)Cc2cccs2)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H26N2O3S/c1-33-24-16-14-21(15-17-24)20-29-28(32)27(22-9-4-2-5-10-22)30(23-11-6-3-7-12-23)26(31)19-25-13-8-18-34-25/h2-18,27H,19-20H2,1H3,(H,29,32)/t27-/m0/s1 |
| InChIKey | VWRQVUKXSVPKLE-MHZLTWQESA-N |
| XLogP | 5.39 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.59 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |