C27H24N2O2S — CID 1434572
(2S)-N-benzyl-2-phenyl-2-(N-(2-thiophen-2-ylacetyl)anilino)acetamide (PubChem CID 1434572) has the molecular formula C27H24N2O2S and a molecular weight of 440.57 g/mol. Its IUPAC name is (2S)-N-benzyl-2-phenyl-2-(N-(2-thiophen-2-ylacetyl)anilino)acetamide.
| Compound Name | (2S)-N-benzyl-2-phenyl-2-(N-(2-thiophen-2-ylacetyl)anilino)acetamide |
|---|---|
| PubChem CID | 1434572 |
| Molecular Formula | C27H24N2O2S |
| Molecular Weight | 440.57 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | (2S)-N-benzyl-2-phenyl-2-(N-(2-thiophen-2-ylacetyl)anilino)acetamide |
| SMILES | O=C(NCc1ccccc1)[C@H](c1ccccc1)N(C(=O)Cc1cccs1)c1ccccc1 |
| InChI | InChI=1S/C27H24N2O2S/c30-25(19-24-17-10-18-32-24)29(23-15-8-3-9-16-23)26(22-13-6-2-7-14-22)27(31)28-20-21-11-4-1-5-12-21/h1-18,26H,19-20H2,(H,28,31)/t26-/m0/s1 |
| InChIKey | AEAAQHMZDTZZOE-SANMLTNESA-N |
| XLogP | 5.38 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.57 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |