C25H26N2O3S — CID 3216673
N-(oxolan-2-ylmethyl)-2-phenyl-2-(N-(2-thiophen-2-ylacetyl)anilino)acetamide (PubChem CID 3216673) has the molecular formula C25H26N2O3S and a molecular weight of 434.56 g/mol. Its IUPAC name is N-(oxolan-2-ylmethyl)-2-phenyl-2-(N-(2-thiophen-2-ylacetyl)anilino)acetamide.
| Compound Name | N-(oxolan-2-ylmethyl)-2-phenyl-2-(N-(2-thiophen-2-ylacetyl)anilino)acetamide |
|---|---|
| PubChem CID | 3216673 |
| Molecular Formula | C25H26N2O3S |
| Molecular Weight | 434.56 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | N-(oxolan-2-ylmethyl)-2-phenyl-2-(N-(2-thiophen-2-ylacetyl)anilino)acetamide |
| SMILES | O=C(NCC1CCCO1)C(c1ccccc1)N(C(=O)Cc1cccs1)c1ccccc1 |
| InChI | InChI=1S/C25H26N2O3S/c28-23(17-22-14-8-16-31-22)27(20-11-5-2-6-12-20)24(19-9-3-1-4-10-19)25(29)26-18-21-13-7-15-30-21/h1-6,8-12,14,16,21,24H,7,13,15,17-18H2,(H,26,29) |
| InChIKey | CCVQQEYXBCUXTE-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.56 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |