C23H24N2O3S2 — CID 3844004
N-(oxolan-2-ylmethyl)-2-thiophen-2-yl-2-(N-(2-thiophen-2-ylacetyl)anilino)acetamide (PubChem CID 3844004) has the molecular formula C23H24N2O3S2 and a molecular weight of 440.59 g/mol. Its IUPAC name is N-(oxolan-2-ylmethyl)-2-thiophen-2-yl-2-(N-(2-thiophen-2-ylacetyl)anilino)acetamide.
| Compound Name | N-(oxolan-2-ylmethyl)-2-thiophen-2-yl-2-(N-(2-thiophen-2-ylacetyl)anilino)acetamide |
|---|---|
| PubChem CID | 3844004 |
| Molecular Formula | C23H24N2O3S2 |
| Molecular Weight | 440.59 g/mol |
| Exact Mass | 440.12 |
| IUPAC Name | N-(oxolan-2-ylmethyl)-2-thiophen-2-yl-2-(N-(2-thiophen-2-ylacetyl)anilino)acetamide |
| SMILES | O=C(NCC1CCCO1)C(c1cccs1)N(C(=O)Cc1cccs1)c1ccccc1 |
| InChI | InChI=1S/C23H24N2O3S2/c26-21(15-19-10-5-13-29-19)25(17-7-2-1-3-8-17)22(20-11-6-14-30-20)23(27)24-16-18-9-4-12-28-18/h1-3,5-8,10-11,13-14,18,22H,4,9,12,15-16H2,(H,24,27) |
| InChIKey | HOYIWCDVWRVBIZ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.59 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |