C28H25FN2O2S — CID 3201948
N-benzyl-2-[(4-fluorophenyl)methyl-(2-thiophen-2-ylacetyl)amino]-2-phenylacetamide (PubChem CID 3201948) has the molecular formula C28H25FN2O2S and a molecular weight of 472.59 g/mol. Its IUPAC name is N-benzyl-2-[(4-fluorophenyl)methyl-(2-thiophen-2-ylacetyl)amino]-2-phenylacetamide.
| Compound Name | N-benzyl-2-[(4-fluorophenyl)methyl-(2-thiophen-2-ylacetyl)amino]-2-phenylacetamide |
|---|---|
| PubChem CID | 3201948 |
| Molecular Formula | C28H25FN2O2S |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.16 |
| IUPAC Name | N-benzyl-2-[(4-fluorophenyl)methyl-(2-thiophen-2-ylacetyl)amino]-2-phenylacetamide |
| SMILES | O=C(NCc1ccccc1)C(c1ccccc1)N(Cc1ccc(F)cc1)C(=O)Cc1cccs1 |
| InChI | InChI=1S/C28H25FN2O2S/c29-24-15-13-22(14-16-24)20-31(26(32)18-25-12-7-17-34-25)27(23-10-5-2-6-11-23)28(33)30-19-21-8-3-1-4-9-21/h1-17,27H,18-20H2,(H,30,33) |
| InChIKey | WRTOCDCUIMAQMS-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |