C29H28N2O2S — CID 1434299
(2S)-N-benzyl-2-[benzyl-(2-thiophen-2-ylacetyl)amino]-2-(2-methylphenyl)acetamide (PubChem CID 1434299) has the molecular formula C29H28N2O2S and a molecular weight of 468.62 g/mol. Its IUPAC name is (2S)-N-benzyl-2-[benzyl-(2-thiophen-2-ylacetyl)amino]-2-(2-methylphenyl)acetamide.
| Compound Name | (2S)-N-benzyl-2-[benzyl-(2-thiophen-2-ylacetyl)amino]-2-(2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 1434299 |
| Molecular Formula | C29H28N2O2S |
| Molecular Weight | 468.62 g/mol |
| Exact Mass | 468.19 |
| IUPAC Name | (2S)-N-benzyl-2-[benzyl-(2-thiophen-2-ylacetyl)amino]-2-(2-methylphenyl)acetamide |
| SMILES | Cc1ccccc1[C@@H](C(=O)NCc1ccccc1)N(Cc1ccccc1)C(=O)Cc1cccs1 |
| InChI | InChI=1S/C29H28N2O2S/c1-22-11-8-9-17-26(22)28(29(33)30-20-23-12-4-2-5-13-23)31(21-24-14-6-3-7-15-24)27(32)19-25-16-10-18-34-25/h2-18,28H,19-21H2,1H3,(H,30,33)/t28-/m0/s1 |
| InChIKey | HZIARBOQRGRHKO-NDEPHWFRSA-N |
| XLogP | 5.69 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.62 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |