C22H25N5O4S2 — CID 170208351
(2R)-2-[amino-[(Z)-2-amino-3-[(5-phenylthiophen-2-yl)sulfinylamino]prop-1-enyl]amino]-N-hydroxy-3-(4-hydroxyphenyl)propanamide (PubChem CID 170208351) has the molecular formula C22H25N5O4S2 and a molecular weight of 487.61 g/mol. Its IUPAC name is (2R)-2-[amino-[(Z)-2-amino-3-[(5-phenylthiophen-2-yl)sulfinylamino]prop-1-enyl]amino]-N-hydroxy-3-(4-hydroxyphenyl)propanamide.
| Compound Name | (2R)-2-[amino-[(Z)-2-amino-3-[(5-phenylthiophen-2-yl)sulfinylamino]prop-1-enyl]amino]-N-hydroxy-3-(4-hydroxyphenyl)propanamide |
|---|---|
| PubChem CID | 170208351 |
| Molecular Formula | C22H25N5O4S2 |
| Molecular Weight | 487.61 g/mol |
| Exact Mass | 487.13 |
| IUPAC Name | (2R)-2-[amino-[(Z)-2-amino-3-[(5-phenylthiophen-2-yl)sulfinylamino]prop-1-enyl]amino]-N-hydroxy-3-(4-hydroxyphenyl)propanamide |
| SMILES | N/C(=C\N(N)[C@H](Cc1ccc(O)cc1)C(=O)NO)CNS(=O)c1ccc(-c2ccccc2)s1 |
| InChI | InChI=1S/C22H25N5O4S2/c23-17(13-25-33(31)21-11-10-20(32-21)16-4-2-1-3-5-16)14-27(24)19(22(29)26-30)12-15-6-8-18(28)9-7-15/h1-11,14,19,25,28,30H,12-13,23-24H2,(H,26,29)/b17-14-/t19-,33?/m1/s1 |
| InChIKey | MUDGNXUTJBNVCJ-YKASHKDPSA-N |
| XLogP | 1.83 |
| TPSA | 153.94 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.61 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|