C17H22N4O5S2 — CID 167119225
methyl (2S)-2-[amino-[(Z)-2-amino-3-(thiophen-3-ylsulfonylamino)prop-1-enyl]amino]-3-(4-hydroxyphenyl)propanoate (PubChem CID 167119225) has the molecular formula C17H22N4O5S2 and a molecular weight of 426.52 g/mol. Its IUPAC name is methyl (2S)-2-[amino-[(Z)-2-amino-3-(thiophen-3-ylsulfonylamino)prop-1-enyl]amino]-3-(4-hydroxyphenyl)propanoate.
| Compound Name | methyl (2S)-2-[amino-[(Z)-2-amino-3-(thiophen-3-ylsulfonylamino)prop-1-enyl]amino]-3-(4-hydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 167119225 |
| Molecular Formula | C17H22N4O5S2 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.10 |
| IUPAC Name | methyl (2S)-2-[amino-[(Z)-2-amino-3-(thiophen-3-ylsulfonylamino)prop-1-enyl]amino]-3-(4-hydroxyphenyl)propanoate |
| SMILES | COC(=O)[C@H](Cc1ccc(O)cc1)N(N)/C=C(\N)CNS(=O)(=O)c1ccsc1 |
| InChI | InChI=1S/C17H22N4O5S2/c1-26-17(23)16(8-12-2-4-14(22)5-3-12)21(19)10-13(18)9-20-28(24,25)15-6-7-27-11-15/h2-7,10-11,16,20,22H,8-9,18-19H2,1H3/b13-10-/t16-/m0/s1 |
| InChIKey | WGBZTYXKGQUROZ-DDKJEQMHSA-N |
| XLogP | 0.49 |
| TPSA | 147.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|