C27H34N4O5S2 — CID 170206860
methyl (2S)-2-[amino-[(Z)-2-amino-3-[(5-phenylthiophen-2-yl)sulfonylamino]prop-1-enyl]amino]-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]propanoate (PubChem CID 170206860) has the molecular formula C27H34N4O5S2 and a molecular weight of 558.73 g/mol. Its IUPAC name is methyl (2S)-2-[amino-[(Z)-2-amino-3-[(5-phenylthiophen-2-yl)sulfonylamino]prop-1-enyl]amino]-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]propanoate.
| Compound Name | methyl (2S)-2-[amino-[(Z)-2-amino-3-[(5-phenylthiophen-2-yl)sulfonylamino]prop-1-enyl]amino]-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]propanoate |
|---|---|
| PubChem CID | 170206860 |
| Molecular Formula | C27H34N4O5S2 |
| Molecular Weight | 558.73 g/mol |
| Exact Mass | 558.20 |
| IUPAC Name | methyl (2S)-2-[amino-[(Z)-2-amino-3-[(5-phenylthiophen-2-yl)sulfonylamino]prop-1-enyl]amino]-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]propanoate |
| SMILES | COC(=O)[C@H](Cc1ccc(OC(C)(C)C)cc1)N(N)/C=C(\N)CNS(=O)(=O)c1ccc(-c2ccccc2)s1 |
| InChI | InChI=1S/C27H34N4O5S2/c1-27(2,3)36-22-12-10-19(11-13-22)16-23(26(32)35-4)31(29)18-21(28)17-30-38(33,34)25-15-14-24(37-25)20-8-6-5-7-9-20/h5-15,18,23,30H,16-17,28-29H2,1-4H3/b21-18-/t23-/m0/s1 |
| InChIKey | WPLGPQHKQIMNKY-YIUMPIMRSA-N |
| XLogP | 3.63 |
| TPSA | 136.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.73 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|