C24H27N5O4 — CID 154647429
N-[(Z)-2-amino-3-[amino-[4-(hydroxyamino)-1-naphthalen-2-yl-4-oxobutan-2-yl]amino]prop-2-enyl]-4-hydroxybenzamide (PubChem CID 154647429) has the molecular formula C24H27N5O4 and a molecular weight of 449.51 g/mol. Its IUPAC name is N-[(Z)-2-amino-3-[amino-[4-(hydroxyamino)-1-naphthalen-2-yl-4-oxobutan-2-yl]amino]prop-2-enyl]-4-hydroxybenzamide.
| Compound Name | N-[(Z)-2-amino-3-[amino-[4-(hydroxyamino)-1-naphthalen-2-yl-4-oxobutan-2-yl]amino]prop-2-enyl]-4-hydroxybenzamide |
|---|---|
| PubChem CID | 154647429 |
| Molecular Formula | C24H27N5O4 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.21 |
| IUPAC Name | N-[(Z)-2-amino-3-[amino-[4-(hydroxyamino)-1-naphthalen-2-yl-4-oxobutan-2-yl]amino]prop-2-enyl]-4-hydroxybenzamide |
| SMILES | N/C(=C\N(N)C(CC(=O)NO)Cc1ccc2ccccc2c1)CNC(=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C24H27N5O4/c25-20(14-27-24(32)18-7-9-22(30)10-8-18)15-29(26)21(13-23(31)28-33)12-16-5-6-17-3-1-2-4-19(17)11-16/h1-11,15,21,30,33H,12-14,25-26H2,(H,27,32)(H,28,31)/b20-15- |
| InChIKey | LAXNNUXSMSTBBK-HKWRFOASSA-N |
| XLogP | 1.76 |
| TPSA | 153.94 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|