C24H31F2N5O3 — CID 154647531
N-[(Z)-2-amino-3-[amino-[4-(hydroxyamino)-1-naphthalen-2-yl-4-oxobutan-2-yl]amino]prop-2-enyl]-4,4-difluorocyclohexane-1-carboxamide (PubChem CID 154647531) has the molecular formula C24H31F2N5O3 and a molecular weight of 475.54 g/mol. Its IUPAC name is N-[(Z)-2-amino-3-[amino-[4-(hydroxyamino)-1-naphthalen-2-yl-4-oxobutan-2-yl]amino]prop-2-enyl]-4,4-difluorocyclohexane-1-carboxamide.
| Compound Name | N-[(Z)-2-amino-3-[amino-[4-(hydroxyamino)-1-naphthalen-2-yl-4-oxobutan-2-yl]amino]prop-2-enyl]-4,4-difluorocyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 154647531 |
| Molecular Formula | C24H31F2N5O3 |
| Molecular Weight | 475.54 g/mol |
| Exact Mass | 475.24 |
| IUPAC Name | N-[(Z)-2-amino-3-[amino-[4-(hydroxyamino)-1-naphthalen-2-yl-4-oxobutan-2-yl]amino]prop-2-enyl]-4,4-difluorocyclohexane-1-carboxamide |
| SMILES | N/C(=C\N(N)C(CC(=O)NO)Cc1ccc2ccccc2c1)CNC(=O)C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C24H31F2N5O3/c25-24(26)9-7-18(8-10-24)23(33)29-14-20(27)15-31(28)21(13-22(32)30-34)12-16-5-6-17-3-1-2-4-19(17)11-16/h1-6,11,15,18,21,34H,7-10,12-14,27-28H2,(H,29,33)(H,30,32)/b20-15- |
| InChIKey | BSFFEQGFWWNOLZ-HKWRFOASSA-N |
| XLogP | 2.56 |
| TPSA | 133.71 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.54 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|