C25H31F2N5O3 — CID 155008837
N-[(Z)-2-amino-3-[amino-[(2R)-4-(hydroxyamino)-4-oxo-1-(5,6,7,8-tetrahydronaphthalen-2-yl)butan-2-yl]amino]prop-2-enyl]-3,4-difluoro-N-methylbenzamide (PubChem CID 155008837) has the molecular formula C25H31F2N5O3 and a molecular weight of 487.55 g/mol. Its IUPAC name is N-[(Z)-2-amino-3-[amino-[(2R)-4-(hydroxyamino)-4-oxo-1-(5,6,7,8-tetrahydronaphthalen-2-yl)butan-2-yl]amino]prop-2-enyl]-3,4-difluoro-N-methylbenzamide.
| Compound Name | N-[(Z)-2-amino-3-[amino-[(2R)-4-(hydroxyamino)-4-oxo-1-(5,6,7,8-tetrahydronaphthalen-2-yl)butan-2-yl]amino]prop-2-enyl]-3,4-difluoro-N-methylbenzamide |
|---|---|
| PubChem CID | 155008837 |
| Molecular Formula | C25H31F2N5O3 |
| Molecular Weight | 487.55 g/mol |
| Exact Mass | 487.24 |
| IUPAC Name | N-[(Z)-2-amino-3-[amino-[(2R)-4-(hydroxyamino)-4-oxo-1-(5,6,7,8-tetrahydronaphthalen-2-yl)butan-2-yl]amino]prop-2-enyl]-3,4-difluoro-N-methylbenzamide |
| SMILES | CN(C/C(N)=C/N(N)[C@@H](CC(=O)NO)Cc1ccc2c(c1)CCCC2)C(=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C25H31F2N5O3/c1-31(25(34)19-8-9-22(26)23(27)12-19)14-20(28)15-32(29)21(13-24(33)30-35)11-16-6-7-17-4-2-3-5-18(17)10-16/h6-10,12,15,21,35H,2-5,11,13-14,28-29H2,1H3,(H,30,33)/b20-15-/t21-/m1/s1 |
| InChIKey | IDYLQGDBMRZFCW-WOHXKIKESA-N |
| XLogP | 2.40 |
| TPSA | 124.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.55 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|