C26H32F2N6O3 — CID 154647433
N-[(Z)-2-amino-3-[amino-[4-(hydroxyamino)-1-(1H-indol-3-yl)-4-oxobutan-2-yl]amino]prop-2-enyl]-3,4-difluoro-N-(2-methylpropyl)benzamide (PubChem CID 154647433) has the molecular formula C26H32F2N6O3 and a molecular weight of 514.58 g/mol. Its IUPAC name is N-[(Z)-2-amino-3-[amino-[4-(hydroxyamino)-1-(1H-indol-3-yl)-4-oxobutan-2-yl]amino]prop-2-enyl]-3,4-difluoro-N-(2-methylpropyl)benzamide.
| Compound Name | N-[(Z)-2-amino-3-[amino-[4-(hydroxyamino)-1-(1H-indol-3-yl)-4-oxobutan-2-yl]amino]prop-2-enyl]-3,4-difluoro-N-(2-methylpropyl)benzamide |
|---|---|
| PubChem CID | 154647433 |
| Molecular Formula | C26H32F2N6O3 |
| Molecular Weight | 514.58 g/mol |
| Exact Mass | 514.25 |
| IUPAC Name | N-[(Z)-2-amino-3-[amino-[4-(hydroxyamino)-1-(1H-indol-3-yl)-4-oxobutan-2-yl]amino]prop-2-enyl]-3,4-difluoro-N-(2-methylpropyl)benzamide |
| SMILES | CC(C)CN(C/C(N)=C/N(N)C(CC(=O)NO)Cc1c[nH]c2ccccc12)C(=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C26H32F2N6O3/c1-16(2)13-33(26(36)17-7-8-22(27)23(28)10-17)14-19(29)15-34(30)20(11-25(35)32-37)9-18-12-31-24-6-4-3-5-21(18)24/h3-8,10,12,15-16,20,31,37H,9,11,13-14,29-30H2,1-2H3,(H,32,35)/b19-15- |
| InChIKey | OFTFBMWKXFOQTI-CYVLTUHYSA-N |
| XLogP | 3.03 |
| TPSA | 140.71 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.58 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|