C25H28N6O3S2 — CID 170208233
(3R)-3-[amino-[(Z)-2-amino-3-[(5-phenylthiophen-2-yl)sulfinylamino]prop-1-enyl]amino]-N-hydroxy-4-(1H-indol-3-yl)butanamide (PubChem CID 170208233) has the molecular formula C25H28N6O3S2 and a molecular weight of 524.67 g/mol. Its IUPAC name is (3R)-3-[amino-[(Z)-2-amino-3-[(5-phenylthiophen-2-yl)sulfinylamino]prop-1-enyl]amino]-N-hydroxy-4-(1H-indol-3-yl)butanamide.
| Compound Name | (3R)-3-[amino-[(Z)-2-amino-3-[(5-phenylthiophen-2-yl)sulfinylamino]prop-1-enyl]amino]-N-hydroxy-4-(1H-indol-3-yl)butanamide |
|---|---|
| PubChem CID | 170208233 |
| Molecular Formula | C25H28N6O3S2 |
| Molecular Weight | 524.67 g/mol |
| Exact Mass | 524.17 |
| IUPAC Name | (3R)-3-[amino-[(Z)-2-amino-3-[(5-phenylthiophen-2-yl)sulfinylamino]prop-1-enyl]amino]-N-hydroxy-4-(1H-indol-3-yl)butanamide |
| SMILES | N/C(=C\N(N)[C@@H](CC(=O)NO)Cc1c[nH]c2ccccc12)CNS(=O)c1ccc(-c2ccccc2)s1 |
| InChI | InChI=1S/C25H28N6O3S2/c26-19(15-29-36(34)25-11-10-23(35-25)17-6-2-1-3-7-17)16-31(27)20(13-24(32)30-33)12-18-14-28-22-9-5-4-8-21(18)22/h1-11,14,16,20,28-29,33H,12-13,15,26-27H2,(H,30,32)/b19-16-/t20-,36?/m1/s1 |
| InChIKey | XZUOWJZTLCFZBK-REFHKCQNSA-N |
| XLogP | 2.99 |
| TPSA | 149.50 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.67 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|