C26H26N6O4S2 — CID 174220200
(4R)-N-hydroxy-5-(1H-indol-3-yl)-4-[5-[[(5-phenylthiophen-2-yl)sulfonylamino]methyl]triazol-1-yl]pentanamide (PubChem CID 174220200) has the molecular formula C26H26N6O4S2 and a molecular weight of 550.67 g/mol. Its IUPAC name is (4R)-N-hydroxy-5-(1H-indol-3-yl)-4-[5-[[(5-phenylthiophen-2-yl)sulfonylamino]methyl]triazol-1-yl]pentanamide.
| Compound Name | (4R)-N-hydroxy-5-(1H-indol-3-yl)-4-[5-[[(5-phenylthiophen-2-yl)sulfonylamino]methyl]triazol-1-yl]pentanamide |
|---|---|
| PubChem CID | 174220200 |
| Molecular Formula | C26H26N6O4S2 |
| Molecular Weight | 550.67 g/mol |
| Exact Mass | 550.15 |
| IUPAC Name | (4R)-N-hydroxy-5-(1H-indol-3-yl)-4-[5-[[(5-phenylthiophen-2-yl)sulfonylamino]methyl]triazol-1-yl]pentanamide |
| SMILES | O=C(CC[C@H](Cc1c[nH]c2ccccc12)n1nncc1CNS(=O)(=O)c1ccc(-c2ccccc2)s1)NO |
| InChI | InChI=1S/C26H26N6O4S2/c33-25(30-34)12-10-20(14-19-15-27-23-9-5-4-8-22(19)23)32-21(16-28-31-32)17-29-38(35,36)26-13-11-24(37-26)18-6-2-1-3-7-18/h1-9,11,13,15-16,20,27,29,34H,10,12,14,17H2,(H,30,33)/t20-/m1/s1 |
| InChIKey | JPBWCTPQWCGGMR-HXUWFJFHSA-N |
| XLogP | 4.04 |
| TPSA | 142.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.67 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|