C27H25N5O4S2 — CID 164530799
(3R)-N-hydroxy-4-naphthalen-2-yl-3-[4-[[(5-phenylthiophen-2-yl)sulfonylamino]methyl]triazol-1-yl]butanamide (PubChem CID 164530799) has the molecular formula C27H25N5O4S2 and a molecular weight of 547.66 g/mol. Its IUPAC name is (3R)-N-hydroxy-4-naphthalen-2-yl-3-[4-[[(5-phenylthiophen-2-yl)sulfonylamino]methyl]triazol-1-yl]butanamide.
| Compound Name | (3R)-N-hydroxy-4-naphthalen-2-yl-3-[4-[[(5-phenylthiophen-2-yl)sulfonylamino]methyl]triazol-1-yl]butanamide |
|---|---|
| PubChem CID | 164530799 |
| Molecular Formula | C27H25N5O4S2 |
| Molecular Weight | 547.66 g/mol |
| Exact Mass | 547.13 |
| IUPAC Name | (3R)-N-hydroxy-4-naphthalen-2-yl-3-[4-[[(5-phenylthiophen-2-yl)sulfonylamino]methyl]triazol-1-yl]butanamide |
| SMILES | O=C(C[C@@H](Cc1ccc2ccccc2c1)n1cc(CNS(=O)(=O)c2ccc(-c3ccccc3)s2)nn1)NO |
| InChI | InChI=1S/C27H25N5O4S2/c33-26(30-34)16-24(15-19-10-11-20-6-4-5-9-22(20)14-19)32-18-23(29-31-32)17-28-38(35,36)27-13-12-25(37-27)21-7-2-1-3-8-21/h1-14,18,24,28,34H,15-17H2,(H,30,33)/t24-/m1/s1 |
| InChIKey | DCRMODRXEZHGOZ-XMMPIXPASA-N |
| XLogP | 4.32 |
| TPSA | 126.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.66 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|