C24H26N6O6S2 — CID 175485909
(3S)-4-(3,4-dimethoxyphenyl)-N-hydroxy-3-[4-[[(5-pyridin-2-ylthiophen-2-yl)sulfonylamino]methyl]triazol-1-yl]butanamide (PubChem CID 175485909) has the molecular formula C24H26N6O6S2 and a molecular weight of 558.64 g/mol. Its IUPAC name is (3S)-4-(3,4-dimethoxyphenyl)-N-hydroxy-3-[4-[[(5-pyridin-2-ylthiophen-2-yl)sulfonylamino]methyl]triazol-1-yl]butanamide.
| Compound Name | (3S)-4-(3,4-dimethoxyphenyl)-N-hydroxy-3-[4-[[(5-pyridin-2-ylthiophen-2-yl)sulfonylamino]methyl]triazol-1-yl]butanamide |
|---|---|
| PubChem CID | 175485909 |
| Molecular Formula | C24H26N6O6S2 |
| Molecular Weight | 558.64 g/mol |
| Exact Mass | 558.14 |
| IUPAC Name | (3S)-4-(3,4-dimethoxyphenyl)-N-hydroxy-3-[4-[[(5-pyridin-2-ylthiophen-2-yl)sulfonylamino]methyl]triazol-1-yl]butanamide |
| SMILES | COc1ccc(C[C@@H](CC(=O)NO)n2cc(CNS(=O)(=O)c3ccc(-c4ccccn4)s3)nn2)cc1OC |
| InChI | InChI=1S/C24H26N6O6S2/c1-35-20-7-6-16(12-21(20)36-2)11-18(13-23(31)28-32)30-15-17(27-29-30)14-26-38(33,34)24-9-8-22(37-24)19-5-3-4-10-25-19/h3-10,12,15,18,26,32H,11,13-14H2,1-2H3,(H,28,31)/t18-/m0/s1 |
| InChIKey | ASPFIFSRHJAFPP-SFHVURJKSA-N |
| XLogP | 2.58 |
| TPSA | 157.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.64 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|