C24H24N6O6S2 — CID 174220085
4-[5-[[1-[1-(hydroxyamino)-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]triazol-4-yl]methylsulfamoyl]thiophen-2-yl]-N-methylbenzamide (PubChem CID 174220085) has the molecular formula C24H24N6O6S2 and a molecular weight of 556.63 g/mol. Its IUPAC name is 4-[5-[[1-[1-(hydroxyamino)-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]triazol-4-yl]methylsulfamoyl]thiophen-2-yl]-N-methylbenzamide.
| Compound Name | 4-[5-[[1-[1-(hydroxyamino)-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]triazol-4-yl]methylsulfamoyl]thiophen-2-yl]-N-methylbenzamide |
|---|---|
| PubChem CID | 174220085 |
| Molecular Formula | C24H24N6O6S2 |
| Molecular Weight | 556.63 g/mol |
| Exact Mass | 556.12 |
| IUPAC Name | 4-[5-[[1-[1-(hydroxyamino)-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]triazol-4-yl]methylsulfamoyl]thiophen-2-yl]-N-methylbenzamide |
| SMILES | CNC(=O)c1ccc(-c2ccc(S(=O)(=O)NCc3cn(C(Cc4ccc(O)cc4)C(=O)NO)nn3)s2)cc1 |
| InChI | InChI=1S/C24H24N6O6S2/c1-25-23(32)17-6-4-16(5-7-17)21-10-11-22(37-21)38(35,36)26-13-18-14-30(29-27-18)20(24(33)28-34)12-15-2-8-19(31)9-3-15/h2-11,14,20,26,31,34H,12-13H2,1H3,(H,25,32)(H,28,33) |
| InChIKey | NEIZWTRUAQXISG-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 175.54 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.63 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|