C23H23N5O5S2 — CID 175485866
N-hydroxy-3-(4-methoxyphenyl)-2-[4-[[(5-phenylthiophen-2-yl)sulfonylamino]methyl]triazol-1-yl]propanamide (PubChem CID 175485866) has the molecular formula C23H23N5O5S2 and a molecular weight of 513.60 g/mol. Its IUPAC name is N-hydroxy-3-(4-methoxyphenyl)-2-[4-[[(5-phenylthiophen-2-yl)sulfonylamino]methyl]triazol-1-yl]propanamide.
| Compound Name | N-hydroxy-3-(4-methoxyphenyl)-2-[4-[[(5-phenylthiophen-2-yl)sulfonylamino]methyl]triazol-1-yl]propanamide |
|---|---|
| PubChem CID | 175485866 |
| Molecular Formula | C23H23N5O5S2 |
| Molecular Weight | 513.60 g/mol |
| Exact Mass | 513.11 |
| IUPAC Name | N-hydroxy-3-(4-methoxyphenyl)-2-[4-[[(5-phenylthiophen-2-yl)sulfonylamino]methyl]triazol-1-yl]propanamide |
| SMILES | COc1ccc(CC(C(=O)NO)n2cc(CNS(=O)(=O)c3ccc(-c4ccccc4)s3)nn2)cc1 |
| InChI | InChI=1S/C23H23N5O5S2/c1-33-19-9-7-16(8-10-19)13-20(23(29)26-30)28-15-18(25-27-28)14-24-35(31,32)22-12-11-21(34-22)17-5-3-2-4-6-17/h2-12,15,20,24,30H,13-14H2,1H3,(H,26,29) |
| InChIKey | QHHKXYPPDICVAU-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 135.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.60 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|