C25H25N5O6S2 — CID 175485890
3-[5-[[1-[(2S)-1-(hydroxyamino)-3-(4-methoxyphenyl)-1-oxopropan-2-yl]triazol-4-yl]methylsulfonyl]thiophen-2-yl]-N-methylbenzamide (PubChem CID 175485890) has the molecular formula C25H25N5O6S2 and a molecular weight of 555.64 g/mol. Its IUPAC name is 3-[5-[[1-[(2S)-1-(hydroxyamino)-3-(4-methoxyphenyl)-1-oxopropan-2-yl]triazol-4-yl]methylsulfonyl]thiophen-2-yl]-N-methylbenzamide.
| Compound Name | 3-[5-[[1-[(2S)-1-(hydroxyamino)-3-(4-methoxyphenyl)-1-oxopropan-2-yl]triazol-4-yl]methylsulfonyl]thiophen-2-yl]-N-methylbenzamide |
|---|---|
| PubChem CID | 175485890 |
| Molecular Formula | C25H25N5O6S2 |
| Molecular Weight | 555.64 g/mol |
| Exact Mass | 555.12 |
| IUPAC Name | 3-[5-[[1-[(2S)-1-(hydroxyamino)-3-(4-methoxyphenyl)-1-oxopropan-2-yl]triazol-4-yl]methylsulfonyl]thiophen-2-yl]-N-methylbenzamide |
| SMILES | CNC(=O)c1cccc(-c2ccc(S(=O)(=O)Cc3cn([C@@H](Cc4ccc(OC)cc4)C(=O)NO)nn3)s2)c1 |
| InChI | InChI=1S/C25H25N5O6S2/c1-26-24(31)18-5-3-4-17(13-18)22-10-11-23(37-22)38(34,35)15-19-14-30(29-27-19)21(25(32)28-33)12-16-6-8-20(36-2)9-7-16/h3-11,13-14,21,33H,12,15H2,1-2H3,(H,26,31)(H,28,32)/t21-/m0/s1 |
| InChIKey | ZAFRXGQGHMSGKW-NRFANRHFSA-N |
| XLogP | 2.64 |
| TPSA | 152.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.64 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|