C22H23ClN2O5S2 — CID 18931256
N-[5-(5-chloropentanoyl)-2,4-dimethoxyphenyl]-5-pyridin-2-ylthiophene-2-sulfonamide (PubChem CID 18931256) has the molecular formula C22H23ClN2O5S2 and a molecular weight of 495.02 g/mol. Its IUPAC name is N-[5-(5-chloropentanoyl)-2,4-dimethoxyphenyl]-5-pyridin-2-ylthiophene-2-sulfonamide.
| Compound Name | N-[5-(5-chloropentanoyl)-2,4-dimethoxyphenyl]-5-pyridin-2-ylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 18931256 |
| Molecular Formula | C22H23ClN2O5S2 |
| Molecular Weight | 495.02 g/mol |
| Exact Mass | 494.07 |
| IUPAC Name | N-[5-(5-chloropentanoyl)-2,4-dimethoxyphenyl]-5-pyridin-2-ylthiophene-2-sulfonamide |
| SMILES | COc1cc(OC)c(C(=O)CCCCCl)cc1NS(=O)(=O)c1ccc(-c2ccccn2)s1 |
| InChI | InChI=1S/C22H23ClN2O5S2/c1-29-19-14-20(30-2)17(13-15(19)18(26)8-3-5-11-23)25-32(27,28)22-10-9-21(31-22)16-7-4-6-12-24-16/h4,6-7,9-10,12-14,25H,3,5,8,11H2,1-2H3 |
| InChIKey | FZLNPAQHXMBMCS-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.02 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|