C20H21ClF3NO5S — CID 18931280
N-[5-(5-chloropentanoyl)-2,4-dimethoxyphenyl]-4-(trifluoromethyl)benzenesulfonamide (PubChem CID 18931280) has the molecular formula C20H21ClF3NO5S and a molecular weight of 479.90 g/mol. Its IUPAC name is N-[5-(5-chloropentanoyl)-2,4-dimethoxyphenyl]-4-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[5-(5-chloropentanoyl)-2,4-dimethoxyphenyl]-4-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 18931280 |
| Molecular Formula | C20H21ClF3NO5S |
| Molecular Weight | 479.90 g/mol |
| Exact Mass | 479.08 |
| IUPAC Name | N-[5-(5-chloropentanoyl)-2,4-dimethoxyphenyl]-4-(trifluoromethyl)benzenesulfonamide |
| SMILES | COc1cc(OC)c(C(=O)CCCCCl)cc1NS(=O)(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H21ClF3NO5S/c1-29-18-12-19(30-2)16(11-15(18)17(26)5-3-4-10-21)25-31(27,28)14-8-6-13(7-9-14)20(22,23)24/h6-9,11-12,25H,3-5,10H2,1-2H3 |
| InChIKey | KCNIFCANYQJHBW-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.90 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|