C13H16ClNO5 — CID 18931278
5-chloro-1-(2,4-dimethoxy-5-nitrophenyl)pentan-1-one (PubChem CID 18931278) has the molecular formula C13H16ClNO5 and a molecular weight of 301.73 g/mol. Its IUPAC name is 5-chloro-1-(2,4-dimethoxy-5-nitrophenyl)pentan-1-one.
| Compound Name | 5-chloro-1-(2,4-dimethoxy-5-nitrophenyl)pentan-1-one |
|---|---|
| PubChem CID | 18931278 |
| Molecular Formula | C13H16ClNO5 |
| Molecular Weight | 301.73 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | 5-chloro-1-(2,4-dimethoxy-5-nitrophenyl)pentan-1-one |
| SMILES | COc1cc(OC)c([N+](=O)[O-])cc1C(=O)CCCCCl |
| InChI | InChI=1S/C13H16ClNO5/c1-19-12-8-13(20-2)10(15(17)18)7-9(12)11(16)5-3-4-6-14/h7-8H,3-6H2,1-2H3 |
| InChIKey | NCDJVCVFRAJGRM-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.73 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|