C9H8ClNO5 — CID 21406539
2,4-dimethoxy-5-nitrobenzoyl chloride (PubChem CID 21406539) has the molecular formula C9H8ClNO5 and a molecular weight of 245.62 g/mol. Its IUPAC name is 2,4-dimethoxy-5-nitrobenzoyl chloride.
| Compound Name | 2,4-dimethoxy-5-nitrobenzoyl chloride |
|---|---|
| PubChem CID | 21406539 |
| Molecular Formula | C9H8ClNO5 |
| Molecular Weight | 245.62 g/mol |
| Exact Mass | 245.01 |
| IUPAC Name | 2,4-dimethoxy-5-nitrobenzoyl chloride |
| SMILES | COc1cc(OC)c([N+](=O)[O-])cc1C(=O)Cl |
| InChI | InChI=1S/C9H8ClNO5/c1-15-7-4-8(16-2)6(11(13)14)3-5(7)9(10)12/h3-4H,1-2H3 |
| InChIKey | GFYILWGHOHSYFI-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.62 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|