C27H31N5O7S — CID 57202992
4-cyano-N-[5-[5-(2,4-dioxo-1,3,8-triazaspiro[4.5]decan-1-yl)pentanoyl]-2,4-dimethoxyphenyl]benzenesulfonamide (PubChem CID 57202992) has the molecular formula C27H31N5O7S and a molecular weight of 569.64 g/mol. Its IUPAC name is 4-cyano-N-[5-[5-(2,4-dioxo-1,3,8-triazaspiro[4.5]decan-1-yl)pentanoyl]-2,4-dimethoxyphenyl]benzenesulfonamide.
| Compound Name | 4-cyano-N-[5-[5-(2,4-dioxo-1,3,8-triazaspiro[4.5]decan-1-yl)pentanoyl]-2,4-dimethoxyphenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 57202992 |
| Molecular Formula | C27H31N5O7S |
| Molecular Weight | 569.64 g/mol |
| Exact Mass | 569.19 |
| IUPAC Name | 4-cyano-N-[5-[5-(2,4-dioxo-1,3,8-triazaspiro[4.5]decan-1-yl)pentanoyl]-2,4-dimethoxyphenyl]benzenesulfonamide |
| SMILES | COc1cc(OC)c(C(=O)CCCCN2C(=O)NC(=O)C23CCNCC3)cc1NS(=O)(=O)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C27H31N5O7S/c1-38-23-16-24(39-2)21(31-40(36,37)19-8-6-18(17-28)7-9-19)15-20(23)22(33)5-3-4-14-32-26(35)30-25(34)27(32)10-12-29-13-11-27/h6-9,15-16,29,31H,3-5,10-14H2,1-2H3,(H,30,34,35) |
| InChIKey | CSNWMUGWFFBHKO-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 166.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.64 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|