C28H33F3N4O8S — CID 18931112
N-[3-[5-(2,4-dioxo-1,3,8-triazaspiro[4.5]decan-8-yl)pentanoyl]-2,4,6-trimethoxyphenyl]-4-(trifluoromethyl)benzenesulfonamide (PubChem CID 18931112) has the molecular formula C28H33F3N4O8S and a molecular weight of 642.65 g/mol. Its IUPAC name is N-[3-[5-(2,4-dioxo-1,3,8-triazaspiro[4.5]decan-8-yl)pentanoyl]-2,4,6-trimethoxyphenyl]-4-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[3-[5-(2,4-dioxo-1,3,8-triazaspiro[4.5]decan-8-yl)pentanoyl]-2,4,6-trimethoxyphenyl]-4-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 18931112 |
| Molecular Formula | C28H33F3N4O8S |
| Molecular Weight | 642.65 g/mol |
| Exact Mass | 642.20 |
| IUPAC Name | N-[3-[5-(2,4-dioxo-1,3,8-triazaspiro[4.5]decan-8-yl)pentanoyl]-2,4,6-trimethoxyphenyl]-4-(trifluoromethyl)benzenesulfonamide |
| SMILES | COc1cc(OC)c(C(=O)CCCCN2CCC3(CC2)NC(=O)NC3=O)c(OC)c1NS(=O)(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C28H33F3N4O8S/c1-41-20-16-21(42-2)23(34-44(39,40)18-9-7-17(8-10-18)28(29,30)31)24(43-3)22(20)19(36)6-4-5-13-35-14-11-27(12-15-35)25(37)32-26(38)33-27/h7-10,16,34H,4-6,11-15H2,1-3H3,(H2,32,33,37,38) |
| InChIKey | XWOMZKMHYPYGGT-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 152.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.65 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|