C13H23N3O2 — CID 82098568
8-hexyl-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 82098568) has the molecular formula C13H23N3O2 and a molecular weight of 253.35 g/mol. Its IUPAC name is 8-hexyl-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 8-hexyl-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 82098568 |
| Molecular Formula | C13H23N3O2 |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | 8-hexyl-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | CCCCCCN1CCC2(CC1)NC(=O)NC2=O |
| InChI | InChI=1S/C13H23N3O2/c1-2-3-4-5-8-16-9-6-13(7-10-16)11(17)14-12(18)15-13/h2-10H2,1H3,(H2,14,15,17,18) |
| InChIKey | XUCXIUDCTGBOLI-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|