C21H30ClN3O6 — CID 18931240
8-[5-oxo-5-(2,4,5-trimethoxyphenyl)pentyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione;hydrochloride (PubChem CID 18931240) has the molecular formula C21H30ClN3O6 and a molecular weight of 455.94 g/mol. Its IUPAC name is 8-[5-oxo-5-(2,4,5-trimethoxyphenyl)pentyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione;hydrochloride.
| Compound Name | 8-[5-oxo-5-(2,4,5-trimethoxyphenyl)pentyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione;hydrochloride |
|---|---|
| PubChem CID | 18931240 |
| Molecular Formula | C21H30ClN3O6 |
| Molecular Weight | 455.94 g/mol |
| Exact Mass | 455.18 |
| IUPAC Name | 8-[5-oxo-5-(2,4,5-trimethoxyphenyl)pentyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione;hydrochloride |
| SMILES | COc1cc(OC)c(C(=O)CCCCN2CCC3(CC2)NC(=O)NC3=O)cc1OC.Cl |
| InChI | InChI=1S/C21H29N3O6.ClH/c1-28-16-13-18(30-3)17(29-2)12-14(16)15(25)6-4-5-9-24-10-7-21(8-11-24)19(26)22-20(27)23-21;/h12-13H,4-11H2,1-3H3,(H2,22,23,26,27);1H |
| InChIKey | UMPMKINNVSGRCJ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.94 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|