C22H31N3O6 — CID 18931144
3-methyl-8-[5-oxo-5-(2,4,5-trimethoxyphenyl)pentyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 18931144) has the molecular formula C22H31N3O6 and a molecular weight of 433.51 g/mol. Its IUPAC name is 3-methyl-8-[5-oxo-5-(2,4,5-trimethoxyphenyl)pentyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-methyl-8-[5-oxo-5-(2,4,5-trimethoxyphenyl)pentyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 18931144 |
| Molecular Formula | C22H31N3O6 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.22 |
| IUPAC Name | 3-methyl-8-[5-oxo-5-(2,4,5-trimethoxyphenyl)pentyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | COc1cc(OC)c(C(=O)CCCCN2CCC3(CC2)NC(=O)N(C)C3=O)cc1OC |
| InChI | InChI=1S/C22H31N3O6/c1-24-20(27)22(23-21(24)28)8-11-25(12-9-22)10-6-5-7-16(26)15-13-18(30-3)19(31-4)14-17(15)29-2/h13-14H,5-12H2,1-4H3,(H,23,28) |
| InChIKey | BOZUKMDGFNSXDP-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|