C11H17N3O4 — CID 82148087
3-(3-methyl-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-8-yl)propanoic acid (PubChem CID 82148087) has the molecular formula C11H17N3O4 and a molecular weight of 255.27 g/mol. Its IUPAC name is 3-(3-methyl-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-8-yl)propanoic acid.
| Compound Name | 3-(3-methyl-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-8-yl)propanoic acid |
|---|---|
| PubChem CID | 82148087 |
| Molecular Formula | C11H17N3O4 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.12 |
| IUPAC Name | 3-(3-methyl-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-8-yl)propanoic acid |
| SMILES | CN1C(=O)NC2(CCN(CCC(=O)O)CC2)C1=O |
| InChI | InChI=1S/C11H17N3O4/c1-13-9(17)11(12-10(13)18)3-6-14(7-4-11)5-2-8(15)16/h2-7H2,1H3,(H,12,18)(H,15,16) |
| InChIKey | VSVRGOBBGKTFPK-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|