C16H27N3O4 — CID 82148990
4-[8-(3-methylbutyl)-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-3-yl]butanoic acid (PubChem CID 82148990) has the molecular formula C16H27N3O4 and a molecular weight of 325.41 g/mol. Its IUPAC name is 4-[8-(3-methylbutyl)-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-3-yl]butanoic acid.
| Compound Name | 4-[8-(3-methylbutyl)-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-3-yl]butanoic acid |
|---|---|
| PubChem CID | 82148990 |
| Molecular Formula | C16H27N3O4 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.20 |
| IUPAC Name | 4-[8-(3-methylbutyl)-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-3-yl]butanoic acid |
| SMILES | CC(C)CCN1CCC2(CC1)NC(=O)N(CCCC(=O)O)C2=O |
| InChI | InChI=1S/C16H27N3O4/c1-12(2)5-9-18-10-6-16(7-11-18)14(22)19(15(23)17-16)8-3-4-13(20)21/h12H,3-11H2,1-2H3,(H,17,23)(H,20,21) |
| InChIKey | SKFZHQNRAMLDSA-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|