C14H22N4O5 — CID 82148992
4-[8-[2-(methylamino)-2-oxoethyl]-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-3-yl]butanoic acid (PubChem CID 82148992) has the molecular formula C14H22N4O5 and a molecular weight of 326.35 g/mol. Its IUPAC name is 4-[8-[2-(methylamino)-2-oxoethyl]-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-3-yl]butanoic acid.
| Compound Name | 4-[8-[2-(methylamino)-2-oxoethyl]-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-3-yl]butanoic acid |
|---|---|
| PubChem CID | 82148992 |
| Molecular Formula | C14H22N4O5 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | 4-[8-[2-(methylamino)-2-oxoethyl]-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-3-yl]butanoic acid |
| SMILES | CNC(=O)CN1CCC2(CC1)NC(=O)N(CCCC(=O)O)C2=O |
| InChI | InChI=1S/C14H22N4O5/c1-15-10(19)9-17-7-4-14(5-8-17)12(22)18(13(23)16-14)6-2-3-11(20)21/h2-9H2,1H3,(H,15,19)(H,16,23)(H,20,21) |
| InChIKey | GYRMKJXLIIFDTH-UHFFFAOYSA-N |
| XLogP | -1.02 |
| TPSA | 119.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|