C19H23Cl2N3O4 — CID 18931204
8-[5-(3,5-dichloro-2-methoxyphenyl)-5-oxopentyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 18931204) has the molecular formula C19H23Cl2N3O4 and a molecular weight of 428.32 g/mol. Its IUPAC name is 8-[5-(3,5-dichloro-2-methoxyphenyl)-5-oxopentyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 8-[5-(3,5-dichloro-2-methoxyphenyl)-5-oxopentyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 18931204 |
| Molecular Formula | C19H23Cl2N3O4 |
| Molecular Weight | 428.32 g/mol |
| Exact Mass | 427.11 |
| IUPAC Name | 8-[5-(3,5-dichloro-2-methoxyphenyl)-5-oxopentyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | COc1c(Cl)cc(Cl)cc1C(=O)CCCCN1CCC2(CC1)NC(=O)NC2=O |
| InChI | InChI=1S/C19H23Cl2N3O4/c1-28-16-13(10-12(20)11-14(16)21)15(25)4-2-3-7-24-8-5-19(6-9-24)17(26)22-18(27)23-19/h10-11H,2-9H2,1H3,(H2,22,23,26,27) |
| InChIKey | JQSDDPGJUXOEJW-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.32 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|