C10H11Cl2NO2 — CID 82296158
3-amino-1-(3,5-dichloro-2-methoxyphenyl)propan-1-one (PubChem CID 82296158) has the molecular formula C10H11Cl2NO2 and a molecular weight of 248.11 g/mol. Its IUPAC name is 3-amino-1-(3,5-dichloro-2-methoxyphenyl)propan-1-one.
| Compound Name | 3-amino-1-(3,5-dichloro-2-methoxyphenyl)propan-1-one |
|---|---|
| PubChem CID | 82296158 |
| Molecular Formula | C10H11Cl2NO2 |
| Molecular Weight | 248.11 g/mol |
| Exact Mass | 247.02 |
| IUPAC Name | 3-amino-1-(3,5-dichloro-2-methoxyphenyl)propan-1-one |
| SMILES | COc1c(Cl)cc(Cl)cc1C(=O)CCN |
| InChI | InChI=1S/C10H11Cl2NO2/c1-15-10-7(9(14)2-3-13)4-6(11)5-8(10)12/h4-5H,2-3,13H2,1H3 |
| InChIKey | DDFCJRZUCHXBNV-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.11 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |