C11H11Cl3O2 — CID 82267037
3-chloro-1-(3,5-dichloro-2-ethoxyphenyl)propan-1-one (PubChem CID 82267037) has the molecular formula C11H11Cl3O2 and a molecular weight of 281.57 g/mol. Its IUPAC name is 3-chloro-1-(3,5-dichloro-2-ethoxyphenyl)propan-1-one.
| Compound Name | 3-chloro-1-(3,5-dichloro-2-ethoxyphenyl)propan-1-one |
|---|---|
| PubChem CID | 82267037 |
| Molecular Formula | C11H11Cl3O2 |
| Molecular Weight | 281.57 g/mol |
| Exact Mass | 279.98 |
| IUPAC Name | 3-chloro-1-(3,5-dichloro-2-ethoxyphenyl)propan-1-one |
| SMILES | CCOc1c(Cl)cc(Cl)cc1C(=O)CCCl |
| InChI | InChI=1S/C11H11Cl3O2/c1-2-16-11-8(10(15)3-4-12)5-7(13)6-9(11)14/h5-6H,2-4H2,1H3 |
| InChIKey | HELHYQJRMFZUAF-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.57 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|