C12H15Cl3O — CID 83941177
1,5-dichloro-3-(4-chlorobutan-2-yl)-2-ethoxybenzene (PubChem CID 83941177) has the molecular formula C12H15Cl3O and a molecular weight of 281.61 g/mol. Its IUPAC name is 1,5-dichloro-3-(4-chlorobutan-2-yl)-2-ethoxybenzene.
| Compound Name | 1,5-dichloro-3-(4-chlorobutan-2-yl)-2-ethoxybenzene |
|---|---|
| PubChem CID | 83941177 |
| Molecular Formula | C12H15Cl3O |
| Molecular Weight | 281.61 g/mol |
| Exact Mass | 280.02 |
| IUPAC Name | 1,5-dichloro-3-(4-chlorobutan-2-yl)-2-ethoxybenzene |
| SMILES | CCOc1c(Cl)cc(Cl)cc1C(C)CCCl |
| InChI | InChI=1S/C12H15Cl3O/c1-3-16-12-10(8(2)4-5-13)6-9(14)7-11(12)15/h6-8H,3-5H2,1-2H3 |
| InChIKey | KADUSQBURAAHLP-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.61 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|