C14H21Cl2NO2 — CID 83941192
2-(aminomethyl)-4-(3,5-dichloro-2-ethoxyphenyl)pentan-1-ol (PubChem CID 83941192) has the molecular formula C14H21Cl2NO2 and a molecular weight of 306.23 g/mol. Its IUPAC name is 2-(aminomethyl)-4-(3,5-dichloro-2-ethoxyphenyl)pentan-1-ol.
| Compound Name | 2-(aminomethyl)-4-(3,5-dichloro-2-ethoxyphenyl)pentan-1-ol |
|---|---|
| PubChem CID | 83941192 |
| Molecular Formula | C14H21Cl2NO2 |
| Molecular Weight | 306.23 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | 2-(aminomethyl)-4-(3,5-dichloro-2-ethoxyphenyl)pentan-1-ol |
| SMILES | CCOc1c(Cl)cc(Cl)cc1C(C)CC(CN)CO |
| InChI | InChI=1S/C14H21Cl2NO2/c1-3-19-14-12(5-11(15)6-13(14)16)9(2)4-10(7-17)8-18/h5-6,9-10,18H,3-4,7-8,17H2,1-2H3 |
| InChIKey | HPZLZNWNQKIBMK-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.23 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |