C13H20Cl2N2O — CID 83941186
2-[2-(3,5-dichloro-2-ethoxyphenyl)ethyl]propane-1,3-diamine (PubChem CID 83941186) has the molecular formula C13H20Cl2N2O and a molecular weight of 291.22 g/mol. Its IUPAC name is 2-[2-(3,5-dichloro-2-ethoxyphenyl)ethyl]propane-1,3-diamine.
| Compound Name | 2-[2-(3,5-dichloro-2-ethoxyphenyl)ethyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 83941186 |
| Molecular Formula | C13H20Cl2N2O |
| Molecular Weight | 291.22 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | 2-[2-(3,5-dichloro-2-ethoxyphenyl)ethyl]propane-1,3-diamine |
| SMILES | CCOc1c(Cl)cc(Cl)cc1CCC(CN)CN |
| InChI | InChI=1S/C13H20Cl2N2O/c1-2-18-13-10(4-3-9(7-16)8-17)5-11(14)6-12(13)15/h5-6,9H,2-4,7-8,16-17H2,1H3 |
| InChIKey | CLUAPIVZTOBDSC-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.22 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |