C15H25ClN2O2 — CID 83943406
2-[2-(5-chloro-2,4-diethoxyphenyl)ethyl]propane-1,3-diamine (PubChem CID 83943406) has the molecular formula C15H25ClN2O2 and a molecular weight of 300.83 g/mol. Its IUPAC name is 2-[2-(5-chloro-2,4-diethoxyphenyl)ethyl]propane-1,3-diamine.
| Compound Name | 2-[2-(5-chloro-2,4-diethoxyphenyl)ethyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 83943406 |
| Molecular Formula | C15H25ClN2O2 |
| Molecular Weight | 300.83 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | 2-[2-(5-chloro-2,4-diethoxyphenyl)ethyl]propane-1,3-diamine |
| SMILES | CCOc1cc(OCC)c(CCC(CN)CN)cc1Cl |
| InChI | InChI=1S/C15H25ClN2O2/c1-3-19-14-8-15(20-4-2)13(16)7-12(14)6-5-11(9-17)10-18/h7-8,11H,3-6,9-10,17-18H2,1-2H3 |
| InChIKey | PJJHWQSCCLOQSJ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.83 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |