C13H16Cl2O — CID 83941256
1,5-dichloro-2-ethoxy-3-(2-methylbut-3-enyl)benzene (PubChem CID 83941256) has the molecular formula C13H16Cl2O and a molecular weight of 259.18 g/mol. Its IUPAC name is 1,5-dichloro-2-ethoxy-3-(2-methylbut-3-enyl)benzene.
| Compound Name | 1,5-dichloro-2-ethoxy-3-(2-methylbut-3-enyl)benzene |
|---|---|
| PubChem CID | 83941256 |
| Molecular Formula | C13H16Cl2O |
| Molecular Weight | 259.18 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | 1,5-dichloro-2-ethoxy-3-(2-methylbut-3-enyl)benzene |
| SMILES | C=CC(C)Cc1cc(Cl)cc(Cl)c1OCC |
| InChI | InChI=1S/C13H16Cl2O/c1-4-9(3)6-10-7-11(14)8-12(15)13(10)16-5-2/h4,7-9H,1,5-6H2,2-3H3 |
| InChIKey | DGFOSXJBTJATKS-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.18 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|