C15H23Cl2NO — CID 63421886
1-[3,5-dichloro-2-(2-methylpentoxy)phenyl]propan-2-amine (PubChem CID 63421886) has the molecular formula C15H23Cl2NO and a molecular weight of 304.26 g/mol. Its IUPAC name is 1-[3,5-dichloro-2-(2-methylpentoxy)phenyl]propan-2-amine.
| Compound Name | 1-[3,5-dichloro-2-(2-methylpentoxy)phenyl]propan-2-amine |
|---|---|
| PubChem CID | 63421886 |
| Molecular Formula | C15H23Cl2NO |
| Molecular Weight | 304.26 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | 1-[3,5-dichloro-2-(2-methylpentoxy)phenyl]propan-2-amine |
| SMILES | CCCC(C)COc1c(Cl)cc(Cl)cc1CC(C)N |
| InChI | InChI=1S/C15H23Cl2NO/c1-4-5-10(2)9-19-15-12(6-11(3)18)7-13(16)8-14(15)17/h7-8,10-11H,4-6,9,18H2,1-3H3 |
| InChIKey | DRUYLPDXKKEYFZ-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.26 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |