C14H19BrCl2O — CID 114200333
1-(bromomethyl)-3,5-dichloro-2-(2,4-dimethylpentoxy)benzene (PubChem CID 114200333) has the molecular formula C14H19BrCl2O and a molecular weight of 354.12 g/mol. Its IUPAC name is 1-(bromomethyl)-3,5-dichloro-2-(2,4-dimethylpentoxy)benzene.
| Compound Name | 1-(bromomethyl)-3,5-dichloro-2-(2,4-dimethylpentoxy)benzene |
|---|---|
| PubChem CID | 114200333 |
| Molecular Formula | C14H19BrCl2O |
| Molecular Weight | 354.12 g/mol |
| Exact Mass | 352.00 |
| IUPAC Name | 1-(bromomethyl)-3,5-dichloro-2-(2,4-dimethylpentoxy)benzene |
| SMILES | CC(C)CC(C)COc1c(Cl)cc(Cl)cc1CBr |
| InChI | InChI=1S/C14H19BrCl2O/c1-9(2)4-10(3)8-18-14-11(7-15)5-12(16)6-13(14)17/h5-6,9-10H,4,7-8H2,1-3H3 |
| InChIKey | OGSZPZMCSRCZPX-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.12 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|